C18H36O2 — CID 174910450
2,9-diethyltetradecanoic acid (PubChem CID 174910450) has the molecular formula C18H36O2 and a molecular weight of 284.48 g/mol. Its IUPAC name is 2,9-diethyltetradecanoic acid.
| Compound Name | 2,9-diethyltetradecanoic acid |
|---|---|
| PubChem CID | 174910450 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | 2,9-diethyltetradecanoic acid |
| SMILES | CCCCCC(CC)CCCCCCC(CC)C(=O)O |
| InChI | InChI=1S/C18H36O2/c1-4-7-10-13-16(5-2)14-11-8-9-12-15-17(6-3)18(19)20/h16-17H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | PZEDZOWNZMJOAR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|