C40H50O4 — CID 118505519
(2-hydroxy-1,2,2-triphenylethyl) (3R,11Z,14Z,17Z)-3-hydroxyicosa-11,14,17-trienoate (PubChem CID 118505519) has the molecular formula C40H50O4 and a molecular weight of 594.84 g/mol. Its IUPAC name is (2-hydroxy-1,2,2-triphenylethyl) (3R,11Z,14Z,17Z)-3-hydroxyicosa-11,14,17-trienoate.
| Compound Name | (2-hydroxy-1,2,2-triphenylethyl) (3R,11Z,14Z,17Z)-3-hydroxyicosa-11,14,17-trienoate |
|---|---|
| PubChem CID | 118505519 |
| Molecular Formula | C40H50O4 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | (2-hydroxy-1,2,2-triphenylethyl) (3R,11Z,14Z,17Z)-3-hydroxyicosa-11,14,17-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC[C@@H](O)CC(=O)OC(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H50O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-25-32-37(41)33-38(42)44-39(34-26-19-16-20-27-34)40(43,35-28-21-17-22-29-35)36-30-23-18-24-31-36/h3-4,6-7,9-10,16-24,26-31,37,39,41,43H,2,5,8,11-15,25,32-33H2,1H3/b4-3-,7-6-,10-9-/t37-,39?/m1/s1 |
| InChIKey | WKMJPNXOWXIJFY-QLQAYEELSA-N |
| XLogP | 9.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|