C19H32O4S — CID 141130532
(9Z,12Z,15Z)-2-methyl-1-oxooctadeca-9,12,15-triene-1-sulfonic acid (PubChem CID 141130532) has the molecular formula C19H32O4S and a molecular weight of 356.53 g/mol. Its IUPAC name is (9Z,12Z,15Z)-2-methyl-1-oxooctadeca-9,12,15-triene-1-sulfonic acid.
| Compound Name | (9Z,12Z,15Z)-2-methyl-1-oxooctadeca-9,12,15-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 141130532 |
| Molecular Formula | C19H32O4S |
| Molecular Weight | 356.53 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (9Z,12Z,15Z)-2-methyl-1-oxooctadeca-9,12,15-triene-1-sulfonic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCC(C)C(=O)S(=O)(=O)O |
| InChI | InChI=1S/C19H32O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(2)19(20)24(21,22)23/h4-5,7-8,10-11,18H,3,6,9,12-17H2,1-2H3,(H,21,22,23)/b5-4-,8-7-,11-10- |
| InChIKey | DMJAHQVGDDSBAE-YSTUJMKBSA-N |
| XLogP | 5.24 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|