C37H38O3SSi — CID 10841153
[(1S,2S)-2-(benzenesulfonyl)-4,4-dimethyl-1-phenylpentoxy]-triphenylsilane (PubChem CID 10841153) has the molecular formula C37H38O3SSi and a molecular weight of 590.86 g/mol. Its IUPAC name is [(1S,2S)-2-(benzenesulfonyl)-4,4-dimethyl-1-phenylpentoxy]-triphenylsilane.
| Compound Name | [(1S,2S)-2-(benzenesulfonyl)-4,4-dimethyl-1-phenylpentoxy]-triphenylsilane |
|---|---|
| PubChem CID | 10841153 |
| Molecular Formula | C37H38O3SSi |
| Molecular Weight | 590.86 g/mol |
| Exact Mass | 590.23 |
| IUPAC Name | [(1S,2S)-2-(benzenesulfonyl)-4,4-dimethyl-1-phenylpentoxy]-triphenylsilane |
| SMILES | CC(C)(C)C[C@@H]([C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H38O3SSi/c1-37(2,3)29-35(41(38,39)31-21-11-5-12-22-31)36(30-19-9-4-10-20-30)40-42(32-23-13-6-14-24-32,33-25-15-7-16-26-33)34-27-17-8-18-28-34/h4-28,35-36H,29H2,1-3H3/t35-,36-/m0/s1 |
| InChIKey | OFGSQLVURPTONS-ZPGRZCPFSA-N |
| XLogP | 6.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.86 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|