C40H38O2Si2 — CID 102172480
methyl-[(1S,2S)-2-[methyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane (PubChem CID 102172480) has the molecular formula C40H38O2Si2 and a molecular weight of 606.91 g/mol. Its IUPAC name is methyl-[(1S,2S)-2-[methyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane.
| Compound Name | methyl-[(1S,2S)-2-[methyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102172480 |
| Molecular Formula | C40H38O2Si2 |
| Molecular Weight | 606.91 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | methyl-[(1S,2S)-2-[methyl(diphenyl)silyl]oxy-1,2-diphenylethoxy]-diphenylsilane |
| SMILES | C[Si](O[C@@H](c1ccccc1)[C@@H](O[Si](C)(c1ccccc1)c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H38O2Si2/c1-43(35-25-13-5-14-26-35,36-27-15-6-16-28-36)41-39(33-21-9-3-10-22-33)40(34-23-11-4-12-24-34)42-44(2,37-29-17-7-18-30-37)38-31-19-8-20-32-38/h3-32,39-40H,1-2H3/t39-,40-/m0/s1 |
| InChIKey | AYWGVMFAFAIFHB-ZAQUEYBZSA-N |
| XLogP | 7.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|