C16H31NOSi2 — CID 102239963
(1S,2S)-N-methyl-1-phenyl-N-trimethylsilyl-1-trimethylsilyloxypropan-2-amine (PubChem CID 102239963) has the molecular formula C16H31NOSi2 and a molecular weight of 309.60 g/mol. Its IUPAC name is (1S,2S)-N-methyl-1-phenyl-N-trimethylsilyl-1-trimethylsilyloxypropan-2-amine.
| Compound Name | (1S,2S)-N-methyl-1-phenyl-N-trimethylsilyl-1-trimethylsilyloxypropan-2-amine |
|---|---|
| PubChem CID | 102239963 |
| Molecular Formula | C16H31NOSi2 |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1S,2S)-N-methyl-1-phenyl-N-trimethylsilyl-1-trimethylsilyloxypropan-2-amine |
| SMILES | C[C@@H]([C@@H](O[Si](C)(C)C)c1ccccc1)N(C)[Si](C)(C)C |
| InChI | InChI=1S/C16H31NOSi2/c1-14(17(2)19(3,4)5)16(18-20(6,7)8)15-12-10-9-11-13-15/h9-14,16H,1-8H3/t14-,16+/m0/s1 |
| InChIKey | NSADBSUKOIYJDH-GOEBONIOSA-N |
| XLogP | 4.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|