C32H38IOPSi — CID 18942081
triphenyl-[2-[phenyl(trimethylsilyloxy)methyl]butyl]phosphanium iodide (PubChem CID 18942081) has the molecular formula C32H38IOPSi and a molecular weight of 624.62 g/mol. Its IUPAC name is triphenyl-[2-[phenyl(trimethylsilyloxy)methyl]butyl]phosphanium iodide.
| Compound Name | triphenyl-[2-[phenyl(trimethylsilyloxy)methyl]butyl]phosphanium iodide |
|---|---|
| PubChem CID | 18942081 |
| Molecular Formula | C32H38IOPSi |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | triphenyl-[2-[phenyl(trimethylsilyloxy)methyl]butyl]phosphanium iodide |
| SMILES | CCC(C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(O[Si](C)(C)C)c1ccccc1.[I-] |
| InChI | InChI=1S/C32H38OPSi.HI/c1-5-27(32(33-35(2,3)4)28-18-10-6-11-19-28)26-34(29-20-12-7-13-21-29,30-22-14-8-15-23-30)31-24-16-9-17-25-31;/h6-25,27,32H,5,26H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IDEYNBDGPVGTBJ-UHFFFAOYSA-M |
| XLogP | 4.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|