C22H31NO2Si — CID 91753974
2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide (PubChem CID 91753974) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is 2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide.
| Compound Name | 2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide |
|---|---|
| PubChem CID | 91753974 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 2-phenyl-N-[(1S,2R)-1-phenyl-1-trimethylsilyloxypropan-2-yl]butanamide |
| SMILES | CCC(C(=O)N[C@H](C)[C@@H](O[Si](C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NO2Si/c1-6-20(18-13-9-7-10-14-18)22(24)23-17(2)21(25-26(3,4)5)19-15-11-8-12-16-19/h7-17,20-21H,6H2,1-5H3,(H,23,24)/t17-,20?,21-/m1/s1 |
| InChIKey | NOHAOBDJBVQZRR-UBCDJDFNSA-N |
| XLogP | 5.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|