C36H46O5Si2 — CID 139719240
trimethyl-[1-phenoxy-3-(3-phenoxy-3-phenyl-2-trimethylsilyloxypropoxy)-1-phenylpropan-2-yl]oxysilane (PubChem CID 139719240) has the molecular formula C36H46O5Si2 and a molecular weight of 614.93 g/mol. Its IUPAC name is trimethyl-[1-phenoxy-3-(3-phenoxy-3-phenyl-2-trimethylsilyloxypropoxy)-1-phenylpropan-2-yl]oxysilane.
| Compound Name | trimethyl-[1-phenoxy-3-(3-phenoxy-3-phenyl-2-trimethylsilyloxypropoxy)-1-phenylpropan-2-yl]oxysilane |
|---|---|
| PubChem CID | 139719240 |
| Molecular Formula | C36H46O5Si2 |
| Molecular Weight | 614.93 g/mol |
| Exact Mass | 614.29 |
| IUPAC Name | trimethyl-[1-phenoxy-3-(3-phenoxy-3-phenyl-2-trimethylsilyloxypropoxy)-1-phenylpropan-2-yl]oxysilane |
| SMILES | C[Si](C)(C)OC(COCC(O[Si](C)(C)C)C(Oc1ccccc1)c1ccccc1)C(Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H46O5Si2/c1-42(2,3)40-33(35(29-19-11-7-12-20-29)38-31-23-15-9-16-24-31)27-37-28-34(41-43(4,5)6)36(30-21-13-8-14-22-30)39-32-25-17-10-18-26-32/h7-26,33-36H,27-28H2,1-6H3 |
| InChIKey | YIYLKICGTNXQFZ-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.93 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|