C20H25F3O2Si — CID 72713135
(1R,2S)-2-methyl-3-phenyl-1-[2-(trifluoromethyl)phenyl]-3-trimethylsilyloxypropan-1-ol (PubChem CID 72713135) has the molecular formula C20H25F3O2Si and a molecular weight of 382.50 g/mol. Its IUPAC name is (1R,2S)-2-methyl-3-phenyl-1-[2-(trifluoromethyl)phenyl]-3-trimethylsilyloxypropan-1-ol.
| Compound Name | (1R,2S)-2-methyl-3-phenyl-1-[2-(trifluoromethyl)phenyl]-3-trimethylsilyloxypropan-1-ol |
|---|---|
| PubChem CID | 72713135 |
| Molecular Formula | C20H25F3O2Si |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (1R,2S)-2-methyl-3-phenyl-1-[2-(trifluoromethyl)phenyl]-3-trimethylsilyloxypropan-1-ol |
| SMILES | C[C@H](C(O[Si](C)(C)C)c1ccccc1)[C@@H](O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H25F3O2Si/c1-14(18(24)16-12-8-9-13-17(16)20(21,22)23)19(25-26(2,3)4)15-10-6-5-7-11-15/h5-14,18-19,24H,1-4H3/t14-,18+,19?/m0/s1 |
| InChIKey | PKNBXLSQIFMXQG-BQGOGBDGSA-N |
| XLogP | 5.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|