C16H16F3NO — CID 116772777
2-methoxy-2-phenyl-1-[2-(trifluoromethyl)phenyl]ethanamine (PubChem CID 116772777) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-methoxy-2-phenyl-1-[2-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 2-methoxy-2-phenyl-1-[2-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 116772777 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-methoxy-2-phenyl-1-[2-(trifluoromethyl)phenyl]ethanamine |
| SMILES | COC(c1ccccc1)C(N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H16F3NO/c1-21-15(11-7-3-2-4-8-11)14(20)12-9-5-6-10-13(12)16(17,18)19/h2-10,14-15H,20H2,1H3 |
| InChIKey | ZKXTUYREQBJKIU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |