C22H37NO2Si — CID 24769790
(E)-N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropan-2-yl]-N-methylhex-2-enamide (PubChem CID 24769790) has the molecular formula C22H37NO2Si and a molecular weight of 375.63 g/mol. Its IUPAC name is (E)-N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropan-2-yl]-N-methylhex-2-enamide.
| Compound Name | (E)-N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropan-2-yl]-N-methylhex-2-enamide |
|---|---|
| PubChem CID | 24769790 |
| Molecular Formula | C22H37NO2Si |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (E)-N-[(1S,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-phenylpropan-2-yl]-N-methylhex-2-enamide |
| SMILES | CCC/C=C/C(=O)N(C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO2Si/c1-9-10-12-17-20(24)23(6)18(2)21(19-15-13-11-14-16-19)25-26(7,8)22(3,4)5/h11-18,21H,9-10H2,1-8H3/b17-12+/t18-,21+/m0/s1 |
| InChIKey | BTPMJUJJRHWULT-SNLYCYBESA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|