C28H43NO4Si — CID 11190937
ethyl (2R)-2-[[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-ethoxyamino]butanoate (PubChem CID 11190937) has the molecular formula C28H43NO4Si and a molecular weight of 485.74 g/mol. Its IUPAC name is ethyl (2R)-2-[[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-ethoxyamino]butanoate.
| Compound Name | ethyl (2R)-2-[[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-ethoxyamino]butanoate |
|---|---|
| PubChem CID | 11190937 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | ethyl (2R)-2-[[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-ethoxyamino]butanoate |
| SMILES | CCOC(=O)[C@@H](CC)N(OCC)[C@H](c1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H43NO4Si/c1-9-24(27(30)31-10-2)29(32-11-3)25(22-18-14-12-15-19-22)26(23-20-16-13-17-21-23)33-34(7,8)28(4,5)6/h12-21,24-26H,9-11H2,1-8H3/t24-,25-,26+/m1/s1 |
| InChIKey | RNYZOBLGLXLWDK-CYXNTTPDSA-N |
| XLogP | 7.09 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|