C30H46O4Si — CID 101186285
ethyl (2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropyl)-5-phenyl-4-phenylmethoxypentanoate (PubChem CID 101186285) has the molecular formula C30H46O4Si and a molecular weight of 498.78 g/mol. Its IUPAC name is ethyl (2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropyl)-5-phenyl-4-phenylmethoxypentanoate.
| Compound Name | ethyl (2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropyl)-5-phenyl-4-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 101186285 |
| Molecular Formula | C30H46O4Si |
| Molecular Weight | 498.78 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | ethyl (2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-(2-methylpropyl)-5-phenyl-4-phenylmethoxypentanoate |
| SMILES | CCOC(=O)[C@@H](CC(C)C)C[C@@H](OCc1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H46O4Si/c1-9-32-29(31)26(20-23(2)3)21-27(33-22-24-16-12-10-13-17-24)28(25-18-14-11-15-19-25)34-35(7,8)30(4,5)6/h10-19,23,26-28H,9,20-22H2,1-8H3/t26-,27+,28+/m0/s1 |
| InChIKey | UCSANRZRGVRGJF-UPRLRBBYSA-N |
| XLogP | 7.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.78 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|