C24H32O3 — CID 101186253
ethyl (2R)-4-methyl-2-[(2S)-2-(2-methylphenyl)-2-phenylmethoxyethyl]pentanoate (PubChem CID 101186253) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is ethyl (2R)-4-methyl-2-[(2S)-2-(2-methylphenyl)-2-phenylmethoxyethyl]pentanoate.
| Compound Name | ethyl (2R)-4-methyl-2-[(2S)-2-(2-methylphenyl)-2-phenylmethoxyethyl]pentanoate |
|---|---|
| PubChem CID | 101186253 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethyl (2R)-4-methyl-2-[(2S)-2-(2-methylphenyl)-2-phenylmethoxyethyl]pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)C[C@H](OCc1ccccc1)c1ccccc1C |
| InChI | InChI=1S/C24H32O3/c1-5-26-24(25)21(15-18(2)3)16-23(22-14-10-9-11-19(22)4)27-17-20-12-7-6-8-13-20/h6-14,18,21,23H,5,15-17H2,1-4H3/t21?,23-/m0/s1 |
| InChIKey | CKALBRNRHSZLTP-YANBTOMASA-N |
| XLogP | 5.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |