C14H17F3O3 — CID 170096210
2-methylpropyl 3,3,3-trifluoro-2-phenylmethoxypropanoate (PubChem CID 170096210) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 2-methylpropyl 3,3,3-trifluoro-2-phenylmethoxypropanoate.
| Compound Name | 2-methylpropyl 3,3,3-trifluoro-2-phenylmethoxypropanoate |
|---|---|
| PubChem CID | 170096210 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-methylpropyl 3,3,3-trifluoro-2-phenylmethoxypropanoate |
| SMILES | CC(C)COC(=O)C(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O3/c1-10(2)8-20-13(18)12(14(15,16)17)19-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3 |
| InChIKey | HZQZHCKOLSHKPZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |