C22H35NO7S — CID 87366741
2-methylpropyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate (PubChem CID 87366741) has the molecular formula C22H35NO7S and a molecular weight of 457.59 g/mol. Its IUPAC name is 2-methylpropyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate.
| Compound Name | 2-methylpropyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 87366741 |
| Molecular Formula | C22H35NO7S |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-methylpropyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate |
| SMILES | CCC(NC(C)=O)S(=O)(=O)OCC(C)(C)[C@@H](OCc1ccccc1)C(=O)OCC(C)C |
| InChI | InChI=1S/C22H35NO7S/c1-7-19(23-17(4)24)31(26,27)30-15-22(5,6)20(21(25)29-13-16(2)3)28-14-18-11-9-8-10-12-18/h8-12,16,19-20H,7,13-15H2,1-6H3,(H,23,24)/t19?,20-/m0/s1 |
| InChIKey | DGTXENCNKYZXBK-ANYOKISRSA-N |
| XLogP | 3.02 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|