C32H45NO10S — CID 87423220
1-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxyethyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate (PubChem CID 87423220) has the molecular formula C32H45NO10S and a molecular weight of 635.78 g/mol. Its IUPAC name is 1-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxyethyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate.
| Compound Name | 1-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxyethyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate |
|---|---|
| PubChem CID | 87423220 |
| Molecular Formula | C32H45NO10S |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.28 |
| IUPAC Name | 1-(2,2-dimethyl-3-phenylmethoxypropanoyl)oxyethyl (2R)-4-(1-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phenylmethoxybutanoate |
| SMILES | CCC(NC(C)=O)S(=O)(=O)OCC(C)(C)[C@@H](OCc1ccccc1)C(=O)OC(C)OC(=O)C(C)(C)COCc1ccccc1 |
| InChI | InChI=1S/C32H45NO10S/c1-8-27(33-23(2)34)44(37,38)41-22-31(4,5)28(40-20-26-17-13-10-14-18-26)29(35)42-24(3)43-30(36)32(6,7)21-39-19-25-15-11-9-12-16-25/h9-18,24,27-28H,8,19-22H2,1-7H3,(H,33,34)/t24?,27?,28-/m0/s1 |
| InChIKey | HVHQYHMODXSHOC-NMPMCGMKSA-N |
| XLogP | 4.49 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|