C44H52N2O2Si — CID 11607153
(3S)-N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-3-(dibenzylamino)-N-methylbutanamide (PubChem CID 11607153) has the molecular formula C44H52N2O2Si and a molecular weight of 669.00 g/mol. Its IUPAC name is (3S)-N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-3-(dibenzylamino)-N-methylbutanamide.
| Compound Name | (3S)-N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-3-(dibenzylamino)-N-methylbutanamide |
|---|---|
| PubChem CID | 11607153 |
| Molecular Formula | C44H52N2O2Si |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.38 |
| IUPAC Name | (3S)-N-[(1S,2S)-1-[tert-butyl(diphenyl)silyl]oxy-1-phenylpropan-2-yl]-3-(dibenzylamino)-N-methylbutanamide |
| SMILES | C[C@@H](CC(=O)N(C)[C@@H](C)[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C44H52N2O2Si/c1-35(46(33-37-22-12-7-13-23-37)34-38-24-14-8-15-25-38)32-42(47)45(6)36(2)43(39-26-16-9-17-27-39)48-49(44(3,4)5,40-28-18-10-19-29-40)41-30-20-11-21-31-41/h7-31,35-36,43H,32-34H2,1-6H3/t35-,36-,43+/m0/s1 |
| InChIKey | YPKLOIQEYRWOGG-UFNASBJGSA-N |
| XLogP | 8.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|