C28H34O3Si — CID 101072666
(1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methyl-1-phenylpentan-3-one (PubChem CID 101072666) has the molecular formula C28H34O3Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methyl-1-phenylpentan-3-one.
| Compound Name | (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methyl-1-phenylpentan-3-one |
|---|---|
| PubChem CID | 101072666 |
| Molecular Formula | C28H34O3Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (1R,2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-2-methyl-1-phenylpentan-3-one |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C28H34O3Si/c1-21(27(30)23-15-9-6-10-16-23)26(29)22(2)31-32(28(3,4)5,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-22,27,30H,1-5H3/t21-,22+,27-/m1/s1 |
| InChIKey | SLZNRVSMWZICJI-UMTXDNHDSA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|