C25H32O7Si — CID 140818524
(2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid (PubChem CID 140818524) has the molecular formula C25H32O7Si and a molecular weight of 472.61 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid.
| Compound Name | (2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 140818524 |
| Molecular Formula | C25H32O7Si |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | (2R)-2-[(2R)-2-[(2S)-2-[tert-butyl(diphenyl)silyl]oxypropanoyl]oxypropanoyl]oxypropanoic acid |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O[C@H](C)C(=O)O[C@H](C)C(=O)O |
| InChI | InChI=1S/C25H32O7Si/c1-17(22(26)27)30-23(28)18(2)31-24(29)19(3)32-33(25(4,5)6,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-19H,1-6H3,(H,26,27)/t17-,18-,19+/m1/s1 |
| InChIKey | VBQBUFYQPHTIQI-QRVBRYPASA-N |
| XLogP | 2.90 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|