C25H34O4Si — CID 175693360
(6-methyloxan-3-yl) (2R)-2-[tert-butyl(diphenyl)silyl]oxypropanoate (PubChem CID 175693360) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (6-methyloxan-3-yl) (2R)-2-[tert-butyl(diphenyl)silyl]oxypropanoate.
| Compound Name | (6-methyloxan-3-yl) (2R)-2-[tert-butyl(diphenyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 175693360 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (6-methyloxan-3-yl) (2R)-2-[tert-butyl(diphenyl)silyl]oxypropanoate |
| SMILES | CC1CCC(OC(=O)[C@@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CO1 |
| InChI | InChI=1S/C25H34O4Si/c1-19-16-17-21(18-27-19)28-24(26)20(2)29-30(25(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,19-21H,16-18H2,1-5H3/t19?,20-,21?/m1/s1 |
| InChIKey | CXEIUYZKMGROKW-NYLDSWQDSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|