C39H55NO4Si — CID 16756479
(E,2S,6S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-7-methoxy-N,2,4,6-tetramethylnon-4-enamide (PubChem CID 16756479) has the molecular formula C39H55NO4Si and a molecular weight of 629.96 g/mol. Its IUPAC name is (E,2S,6S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-7-methoxy-N,2,4,6-tetramethylnon-4-enamide.
| Compound Name | (E,2S,6S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-7-methoxy-N,2,4,6-tetramethylnon-4-enamide |
|---|---|
| PubChem CID | 16756479 |
| Molecular Formula | C39H55NO4Si |
| Molecular Weight | 629.96 g/mol |
| Exact Mass | 629.39 |
| IUPAC Name | (E,2S,6S,7R,8S)-8-[tert-butyl(diphenyl)silyl]oxy-N-[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]-7-methoxy-N,2,4,6-tetramethylnon-4-enamide |
| SMILES | CO[C@@H]([C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)/C=C(\C)C[C@H](C)C(=O)N(C)[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C39H55NO4Si/c1-28(27-30(3)38(42)40(9)31(4)36(41)33-20-14-11-15-21-33)26-29(2)37(43-10)32(5)44-45(39(6,7)8,34-22-16-12-17-23-34)35-24-18-13-19-25-35/h11-26,29-32,36-37,41H,27H2,1-10H3/b28-26+/t29-,30-,31-,32-,36+,37+/m0/s1 |
| InChIKey | AWFOYJIBOLGJRQ-UEJKPTTNSA-N |
| XLogP | 7.16 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.96 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|