C42H62O5Si — CID 134940435
methyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12S)-12-[tert-butyl(diphenyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate (PubChem CID 134940435) has the molecular formula C42H62O5Si and a molecular weight of 675.04 g/mol. Its IUPAC name is methyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12S)-12-[tert-butyl(diphenyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12S)-12-[tert-butyl(diphenyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 134940435 |
| Molecular Formula | C42H62O5Si |
| Molecular Weight | 675.04 g/mol |
| Exact Mass | 674.44 |
| IUPAC Name | methyl 2-[(2R,5S,6S)-6-[(2E,4E,6S,8E,10S,11R,12S)-12-[tert-butyl(diphenyl)silyl]oxy-11-methoxy-6,8,10-trimethyltrideca-2,4,8-trien-2-yl]-5-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@H](C)[C@@H](/C(C)=C/C=C/[C@@H](C)C/C(C)=C/[C@H](C)[C@@H](OC)[C@H](C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C42H62O5Si/c1-30(19-18-20-32(3)40-33(4)25-26-36(46-40)29-39(43)44-10)27-31(2)28-34(5)41(45-11)35(6)47-48(42(7,8)9,37-21-14-12-15-22-37)38-23-16-13-17-24-38/h12-24,28,30,33-36,40-41H,25-27,29H2,1-11H3/b19-18+,31-28+,32-20+/t30-,33+,34+,35+,36-,40-,41-/m1/s1 |
| InChIKey | URAZEBREBNICCC-BIQZMLPGSA-N |
| XLogP | 8.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.04 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|