C46H78O6Si3 — CID 132539539
methyl 2-[(2R,6S)-6-[(2R,4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-7-methyl-6-triethylsilyloxynon-8-enyl]oxan-2-yl]acetate (PubChem CID 132539539) has the molecular formula C46H78O6Si3 and a molecular weight of 811.38 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-6-[(2R,4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-7-methyl-6-triethylsilyloxynon-8-enyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,6S)-6-[(2R,4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-7-methyl-6-triethylsilyloxynon-8-enyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 132539539 |
| Molecular Formula | C46H78O6Si3 |
| Molecular Weight | 811.38 g/mol |
| Exact Mass | 810.51 |
| IUPAC Name | methyl 2-[(2R,6S)-6-[(2R,4S,6R,7S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-7-methyl-6-triethylsilyloxynon-8-enyl]oxan-2-yl]acetate |
| SMILES | C=C[C@H](C)[C@@H](C[C@H](C[C@@H](C[C@@H]1CCC[C@H](CC(=O)OC)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C46H78O6Si3/c1-15-36(5)43(52-54(16-2,17-3)18-4)34-40(50-53(13,14)45(6,7)8)33-39(32-37-26-25-27-38(49-37)35-44(47)48-12)51-55(46(9,10)11,41-28-21-19-22-29-41)42-30-23-20-24-31-42/h15,19-24,28-31,36-40,43H,1,16-18,25-27,32-35H2,2-14H3/t36-,37-,38+,39+,40-,43+/m0/s1 |
| InChIKey | YPSMSBSPWQLZTC-XDCRAUOCSA-N |
| XLogP | 11.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.38 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|