C39H62O7Si2 — CID 122377861
methyl 2-[(2R,6S)-6-[(2S,4R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methyl-8-oxooctyl]oxan-2-yl]acetate (PubChem CID 122377861) has the molecular formula C39H62O7Si2 and a molecular weight of 699.09 g/mol. Its IUPAC name is methyl 2-[(2R,6S)-6-[(2S,4R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methyl-8-oxooctyl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,6S)-6-[(2S,4R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methyl-8-oxooctyl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 122377861 |
| Molecular Formula | C39H62O7Si2 |
| Molecular Weight | 699.09 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | methyl 2-[(2R,6S)-6-[(2S,4R,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxy-7-methyl-8-oxooctyl]oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1CCC[C@@H](C[C@@H](C[C@@H](C[C@@H](O)[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C39H62O7Si2/c1-29(28-40)36(41)26-33(45-47(9,10)38(2,3)4)25-32(24-30-18-17-19-31(44-30)27-37(42)43-8)46-48(39(5,6)7,34-20-13-11-14-21-34)35-22-15-12-16-23-35/h11-16,20-23,28-33,36,41H,17-19,24-27H2,1-10H3/t29-,30-,31+,32-,33-,36+/m0/s1 |
| InChIKey | BWTYCCCFOJPWEU-PSYSQCJSSA-N |
| XLogP | 7.19 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.09 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|