C38H46O4Si — CID 134841074
tert-butyl-diphenyl-[(2S,4R)-1-[(4S)-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxypentan-2-yl]oxysilane (PubChem CID 134841074) has the molecular formula C38H46O4Si and a molecular weight of 594.87 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2S,4R)-1-[(4S)-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxypentan-2-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(2S,4R)-1-[(4S)-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxypentan-2-yl]oxysilane |
|---|---|
| PubChem CID | 134841074 |
| Molecular Formula | C38H46O4Si |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | tert-butyl-diphenyl-[(2S,4R)-1-[(4S)-2-phenyl-1,3-dioxan-4-yl]-4-phenylmethoxypentan-2-yl]oxysilane |
| SMILES | C[C@H](C[C@@H](C[C@@H]1CCOC(c2ccccc2)O1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C38H46O4Si/c1-30(40-29-31-17-9-5-10-18-31)27-34(28-33-25-26-39-37(41-33)32-19-11-6-12-20-32)42-43(38(2,3)4,35-21-13-7-14-22-35)36-23-15-8-16-24-36/h5-24,30,33-34,37H,25-29H2,1-4H3/t30-,33+,34+,37?/m1/s1 |
| InChIKey | DTGAAVFECBZJAX-AQRYENFDSA-N |
| XLogP | 7.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|