C31H42O4Si — CID 134841075
(3S,5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-7-phenylmethoxyoctane-1,3-diol (PubChem CID 134841075) has the molecular formula C31H42O4Si and a molecular weight of 506.76 g/mol. Its IUPAC name is (3S,5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-7-phenylmethoxyoctane-1,3-diol.
| Compound Name | (3S,5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-7-phenylmethoxyoctane-1,3-diol |
|---|---|
| PubChem CID | 134841075 |
| Molecular Formula | C31H42O4Si |
| Molecular Weight | 506.76 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (3S,5R,7R)-5-[tert-butyl(diphenyl)silyl]oxy-7-phenylmethoxyoctane-1,3-diol |
| SMILES | C[C@H](C[C@@H](C[C@@H](O)CCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C31H42O4Si/c1-25(34-24-26-14-8-5-9-15-26)22-28(23-27(33)20-21-32)35-36(31(2,3)4,29-16-10-6-11-17-29)30-18-12-7-13-19-30/h5-19,25,27-28,32-33H,20-24H2,1-4H3/t25-,27+,28+/m1/s1 |
| InChIKey | YESYKSLMNPFOAB-PKXQUSJVSA-N |
| XLogP | 5.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.76 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|