C28H44O4Si — CID 57408223
(2S,3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecane-1,2-diol (PubChem CID 57408223) has the molecular formula C28H44O4Si and a molecular weight of 472.74 g/mol. Its IUPAC name is (2S,3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecane-1,2-diol.
| Compound Name | (2S,3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecane-1,2-diol |
|---|---|
| PubChem CID | 57408223 |
| Molecular Formula | C28H44O4Si |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | (2S,3S,5S,7S)-7-[tert-butyl(diphenyl)silyl]oxy-5-methoxy-3-methyldecane-1,2-diol |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)[C@H](O)CO)OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H44O4Si/c1-7-14-23(20-24(31-6)19-22(2)27(30)21-29)32-33(28(3,4)5,25-15-10-8-11-16-25)26-17-12-9-13-18-26/h8-13,15-18,22-24,27,29-30H,7,14,19-21H2,1-6H3/t22-,23-,24-,27+/m0/s1 |
| InChIKey | QICSUUZLOQVGDT-IPVQETTRSA-N |
| XLogP | 4.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|