C37H58O5Si — CID 46844933
tert-butyl-[(4R,6R,8R)-6-methoxy-9-[(2S,4R,6R)-4-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]-8-methylnonan-4-yl]oxy-diphenylsilane (PubChem CID 46844933) has the molecular formula C37H58O5Si and a molecular weight of 610.95 g/mol. Its IUPAC name is tert-butyl-[(4R,6R,8R)-6-methoxy-9-[(2S,4R,6R)-4-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]-8-methylnonan-4-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(4R,6R,8R)-6-methoxy-9-[(2S,4R,6R)-4-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]-8-methylnonan-4-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 46844933 |
| Molecular Formula | C37H58O5Si |
| Molecular Weight | 610.95 g/mol |
| Exact Mass | 610.41 |
| IUPAC Name | tert-butyl-[(4R,6R,8R)-6-methoxy-9-[(2S,4R,6R)-4-(methoxymethoxy)-6-prop-2-enyloxan-2-yl]-8-methylnonan-4-yl]oxy-diphenylsilane |
| SMILES | C=CC[C@@H]1C[C@@H](OCOC)C[C@H](C[C@H](C)C[C@H](C[C@@H](CCC)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC)O1 |
| InChI | InChI=1S/C37H58O5Si/c1-9-17-30-25-33(40-28-38-7)27-34(41-30)24-29(3)23-32(39-8)26-31(18-10-2)42-43(37(4,5)6,35-19-13-11-14-20-35)36-21-15-12-16-22-36/h9,11-16,19-22,29-34H,1,10,17-18,23-28H2,2-8H3/t29-,30-,31-,32-,33-,34+/m1/s1 |
| InChIKey | MDHBSLHOWCXBMC-MZIHQXLJSA-N |
| XLogP | 7.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.95 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|