C38H62O5Si2 — CID 11250839
tert-butyl-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-yl]oxy-diphenylsilane (PubChem CID 11250839) has the molecular formula C38H62O5Si2 and a molecular weight of 655.08 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 11250839 |
| Molecular Formula | C38H62O5Si2 |
| Molecular Weight | 655.08 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | tert-butyl-[(2S,3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4-methyl-1-[(2R,4S,5S)-4-methyl-5-prop-2-enyloxolan-2-yl]pentan-2-yl]oxy-diphenylsilane |
| SMILES | C=CC[C@@H]1O[C@@H](C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OCOC)[C@H](C)CO[Si](C)(C)C(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C38H62O5Si2/c1-13-20-34-29(2)25-31(42-34)26-35(36(40-28-39-10)30(3)27-41-44(11,12)37(4,5)6)43-45(38(7,8)9,32-21-16-14-17-22-32)33-23-18-15-19-24-33/h13-19,21-24,29-31,34-36H,1,20,25-28H2,2-12H3/t29-,30+,31+,34-,35-,36-/m0/s1 |
| InChIKey | NCHWIOLXAPMQQP-KLXFTXDBSA-N |
| XLogP | 8.34 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.08 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|