C30H46O3Si2 — CID 101161585
tert-butyl-[(2R,3S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(Z)-prop-1-enyl]oxolan-3-yl]oxy-diphenylsilane (PubChem CID 101161585) has the molecular formula C30H46O3Si2 and a molecular weight of 510.87 g/mol. Its IUPAC name is tert-butyl-[(2R,3S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(Z)-prop-1-enyl]oxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(Z)-prop-1-enyl]oxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 101161585 |
| Molecular Formula | C30H46O3Si2 |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | tert-butyl-[(2R,3S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(Z)-prop-1-enyl]oxolan-3-yl]oxy-diphenylsilane |
| SMILES | C/C=C\[C@@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C30H46O3Si2/c1-10-17-24-22-27(28(32-24)23-31-34(8,9)29(2,3)4)33-35(30(5,6)7,25-18-13-11-14-19-25)26-20-15-12-16-21-26/h10-21,24,27-28H,22-23H2,1-9H3/b17-10-/t24-,27+,28-/m1/s1 |
| InChIKey | JIDQQOITUQFQIY-BEXHJXKGSA-N |
| XLogP | 6.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|