C32H40O3SeSi — CID 134937702
tert-butyl-[[(4R,5R)-7-ethenyl-4-ethyl-2-(phenylselanylmethyl)-1,3-dioxepan-5-yl]oxy]-diphenylsilane (PubChem CID 134937702) has the molecular formula C32H40O3SeSi and a molecular weight of 579.72 g/mol. Its IUPAC name is tert-butyl-[[(4R,5R)-7-ethenyl-4-ethyl-2-(phenylselanylmethyl)-1,3-dioxepan-5-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4R,5R)-7-ethenyl-4-ethyl-2-(phenylselanylmethyl)-1,3-dioxepan-5-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 134937702 |
| Molecular Formula | C32H40O3SeSi |
| Molecular Weight | 579.72 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | tert-butyl-[[(4R,5R)-7-ethenyl-4-ethyl-2-(phenylselanylmethyl)-1,3-dioxepan-5-yl]oxy]-diphenylsilane |
| SMILES | C=CC1C[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CC)OC(C[Se]c2ccccc2)O1 |
| InChI | InChI=1S/C32H40O3SeSi/c1-6-25-23-30(29(7-2)34-31(33-25)24-36-26-17-11-8-12-18-26)35-37(32(3,4)5,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h6,8-22,25,29-31H,1,7,23-24H2,2-5H3/t25?,29-,30-,31?/m1/s1 |
| InChIKey | ZHGHRHSUFBMNLZ-USNDMVSTSA-N |
| XLogP | 5.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.72 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|