C26H32O4Si — CID 102588754
(4R)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-6-ethenyl-1,3-dioxan-2-one (PubChem CID 102588754) has the molecular formula C26H32O4Si and a molecular weight of 436.62 g/mol. Its IUPAC name is (4R)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-6-ethenyl-1,3-dioxan-2-one.
| Compound Name | (4R)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-6-ethenyl-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 102588754 |
| Molecular Formula | C26H32O4Si |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (4R)-4-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-6-ethenyl-1,3-dioxan-2-one |
| SMILES | C=CC1C[C@H]([C@@H]2C[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)O1 |
| InChI | InChI=1S/C26H32O4Si/c1-5-20-17-24(30-25(27)29-20)23-16-19(23)18-28-31(26(2,3)4,21-12-8-6-9-13-21)22-14-10-7-11-15-22/h5-15,19-20,23-24H,1,16-18H2,2-4H3/t19-,20?,23+,24+/m0/s1 |
| InChIKey | RLABGZPOLSUSGC-UYEHUZEKSA-N |
| XLogP | 4.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|