C28H38O2Si — CID 11327994
tert-butyl-[[(2S,3S,4S,5R)-4-methyl-2,5-bis(prop-2-enyl)oxolan-3-yl]methoxy]-diphenylsilane (PubChem CID 11327994) has the molecular formula C28H38O2Si and a molecular weight of 434.70 g/mol. Its IUPAC name is tert-butyl-[[(2S,3S,4S,5R)-4-methyl-2,5-bis(prop-2-enyl)oxolan-3-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,3S,4S,5R)-4-methyl-2,5-bis(prop-2-enyl)oxolan-3-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11327994 |
| Molecular Formula | C28H38O2Si |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl-[[(2S,3S,4S,5R)-4-methyl-2,5-bis(prop-2-enyl)oxolan-3-yl]methoxy]-diphenylsilane |
| SMILES | C=CC[C@@H]1O[C@H](CC=C)[C@@H](C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O2Si/c1-7-15-26-22(3)25(27(30-26)16-8-2)21-29-31(28(4,5)6,23-17-11-9-12-18-23)24-19-13-10-14-20-24/h7-14,17-20,22,25-27H,1-2,15-16,21H2,3-6H3/t22-,25+,26+,27-/m0/s1 |
| InChIKey | IPWXVYBXZCGGFX-FDBFMKMFSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.70 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|