C25H33FO5Si — CID 140966523
(2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2-prop-2-enoxyoxane-3,4-diol (PubChem CID 140966523) has the molecular formula C25H33FO5Si and a molecular weight of 460.62 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2-prop-2-enoxyoxane-3,4-diol.
| Compound Name | (2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2-prop-2-enoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 140966523 |
| Molecular Formula | C25H33FO5Si |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-2-prop-2-enoxyoxane-3,4-diol |
| SMILES | C=CCO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](F)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H33FO5Si/c1-5-16-29-24-23(28)22(27)21(26)20(31-24)17-30-32(25(2,3)4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h5-15,20-24,27-28H,1,16-17H2,2-4H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | JSXCBNXSWNRGMM-SJSRKZJXSA-N |
| XLogP | 2.55 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|