C23H42O4Si2 — CID 139670541
tert-butyl-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenoxyoxolan-3-yl]oxy-dimethylsilane (PubChem CID 139670541) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is tert-butyl-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenoxyoxolan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenoxyoxolan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 139670541 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | tert-butyl-[(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-phenoxyoxolan-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(Oc2ccccc2)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O4Si2/c1-22(2,3)28(7,8)24-17-20-19(27-29(9,10)23(4,5)6)16-21(26-20)25-18-14-12-11-13-15-18/h11-15,19-21H,16-17H2,1-10H3/t19-,20+,21?/m0/s1 |
| InChIKey | ZJTWQORWMVEFJP-MCOCGALXSA-N |
| XLogP | 6.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|