C31H56O7Si2 — CID 24897800
(2R,3S,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyoxan-3-yl]oxy-2-methyloxan-4-ol (PubChem CID 24897800) has the molecular formula C31H56O7Si2 and a molecular weight of 596.95 g/mol. Its IUPAC name is (2R,3S,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyoxan-3-yl]oxy-2-methyloxan-4-ol.
| Compound Name | (2R,3S,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyoxan-3-yl]oxy-2-methyloxan-4-ol |
|---|---|
| PubChem CID | 24897800 |
| Molecular Formula | C31H56O7Si2 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | (2R,3S,4R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(2R,3R,4R,6R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-6-phenylmethoxyoxan-3-yl]oxy-2-methyloxan-4-ol |
| SMILES | C[C@H]1O[C@@H](OCc2ccccc2)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1CC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C31H56O7Si2/c1-21-28(38-40(11,12)31(6,7)8)24(32)18-27(35-21)36-29-22(2)34-26(33-20-23-16-14-13-15-17-23)19-25(29)37-39(9,10)30(3,4)5/h13-17,21-22,24-29,32H,18-20H2,1-12H3/t21-,22-,24?,25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | LTVMJKRHGXCHSH-RGRALCEGSA-N |
| XLogP | 7.00 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|