C24H41ClN2O3Si2 — CID 140731389
tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(4-chloropyrrolo[3,2-c]pyridin-1-yl)oxolan-2-yl]methoxy]-dimethylsilane (PubChem CID 140731389) has the molecular formula C24H41ClN2O3Si2 and a molecular weight of 497.23 g/mol. Its IUPAC name is tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(4-chloropyrrolo[3,2-c]pyridin-1-yl)oxolan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(4-chloropyrrolo[3,2-c]pyridin-1-yl)oxolan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 140731389 |
| Molecular Formula | C24H41ClN2O3Si2 |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | tert-butyl-[[3-[tert-butyl(dimethyl)silyl]oxy-5-(4-chloropyrrolo[3,2-c]pyridin-1-yl)oxolan-2-yl]methoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(n2ccc3c(Cl)nccc32)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H41ClN2O3Si2/c1-23(2,3)31(7,8)28-16-20-19(30-32(9,10)24(4,5)6)15-21(29-20)27-14-12-17-18(27)11-13-26-22(17)25/h11-14,19-21H,15-16H2,1-10H3 |
| InChIKey | SLVZAKXPDHLEMI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|