C21H39N2O5Si2 — CID 101264549
CID 101264549 (PubChem CID 101264549) has the molecular formula C21H39N2O5Si2 and a molecular weight of 455.72 g/mol.
| Compound Name | CID 101264549 |
|---|---|
| PubChem CID | 101264549 |
| Molecular Formula | C21H39N2O5Si2 |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2c[c]c(=O)[nH]c2=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39N2O5Si2/c1-20(2,3)29(7,8)26-14-16-15(28-30(9,10)21(4,5)6)13-18(27-16)23-12-11-17(24)22-19(23)25/h12,15-16,18H,13-14H2,1-10H3,(H,22,24,25)/t15-,16+,18+/m0/s1 |
| InChIKey | STIYNJSSUBGSKL-LZLYRXPVSA-N |
| XLogP | 4.04 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|