C28H55N4O5PSi — CID 101468293
1-[(2R,4S,5R)-5-[bis[di(propan-2-yl)amino]phosphanyloxymethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 101468293) has the molecular formula C28H55N4O5PSi and a molecular weight of 586.83 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[bis[di(propan-2-yl)amino]phosphanyloxymethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[bis[di(propan-2-yl)amino]phosphanyloxymethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101468293 |
| Molecular Formula | C28H55N4O5PSi |
| Molecular Weight | 586.83 g/mol |
| Exact Mass | 586.37 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[bis[di(propan-2-yl)amino]phosphanyloxymethyl]-4-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(N(C(C)C)C(C)C)N(C(C)C)C(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C28H55N4O5PSi/c1-18(2)31(19(3)4)38(32(20(5)6)21(7)8)35-17-24-23(37-39(13,14)28(10,11)12)15-25(36-24)30-16-22(9)26(33)29-27(30)34/h16,18-21,23-25H,15,17H2,1-14H3,(H,29,33,34)/t23-,24+,25+/m0/s1 |
| InChIKey | BXJHHIXDMTYWPW-ISJGIBHGSA-N |
| XLogP | 6.00 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.83 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|