C17H28N2O6Si — CID 164745352
methyl (2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate (PubChem CID 164745352) has the molecular formula C17H28N2O6Si and a molecular weight of 384.51 g/mol. Its IUPAC name is methyl (2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate.
| Compound Name | methyl (2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 164745352 |
| Molecular Formula | C17H28N2O6Si |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl (2S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O6Si/c1-10-9-19(16(22)18-14(10)20)12-8-11(13(24-12)15(21)23-5)25-26(6,7)17(2,3)4/h9,11-13H,8H2,1-7H3,(H,18,20,22)/t11?,12-,13+/m1/s1 |
| InChIKey | RZECMSWVPNMMAV-HDYSRYHKSA-N |
| XLogP | 1.70 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|