C20H34N2O4Si — CID 177407271
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-1-enyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 177407271) has the molecular formula C20H34N2O4Si and a molecular weight of 394.59 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-1-enyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-1-enyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 177407271 |
| Molecular Formula | C20H34N2O4Si |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(Z)-pent-1-enyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCC/C=C\[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34N2O4Si/c1-8-9-10-11-15-16(26-27(6,7)20(3,4)5)12-17(25-15)22-13-14(2)18(23)21-19(22)24/h10-11,13,15-17H,8-9,12H2,1-7H3,(H,21,23,24)/b11-10-/t15-,16+,17-/m1/s1 |
| InChIKey | DAKZCNQFHDCCGJ-ZDACWMIXSA-N |
| XLogP | 3.88 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|