C17H29N3O7Si — CID 11133477
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-nitroethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11133477) has the molecular formula C17H29N3O7Si and a molecular weight of 415.52 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-nitroethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-nitroethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11133477 |
| Molecular Formula | C17H29N3O7Si |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxy-2-nitroethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@H](O)C[N+](=O)[O-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H29N3O7Si/c1-10-8-19(16(23)18-15(10)22)13-7-12(27-28(5,6)17(2,3)4)14(26-13)11(21)9-20(24)25/h8,11-14,21H,7,9H2,1-6H3,(H,18,22,23)/t11-,12+,13-,14-/m1/s1 |
| InChIKey | CJLAXRLLUUTIKD-XJFOESAGSA-N |
| XLogP | 1.16 |
| TPSA | 136.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|