C31H39BrN2O5Si — CID 15451457
1-[(2R,4S,5R)-5-[(E,1S)-6-bromo-1-hydroxyhex-3-enyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 15451457) has the molecular formula C31H39BrN2O5Si and a molecular weight of 627.65 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[(E,1S)-6-bromo-1-hydroxyhex-3-enyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[(E,1S)-6-bromo-1-hydroxyhex-3-enyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 15451457 |
| Molecular Formula | C31H39BrN2O5Si |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[(E,1S)-6-bromo-1-hydroxyhex-3-enyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]([C@@H](O)C/C=C/CCBr)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C31H39BrN2O5Si/c1-22-21-34(30(37)33-29(22)36)27-20-26(28(38-27)25(35)18-12-7-13-19-32)39-40(31(2,3)4,23-14-8-5-9-15-23)24-16-10-6-11-17-24/h5-12,14-17,21,25-28,35H,13,18-20H2,1-4H3,(H,33,36,37)/b12-7+/t25-,26-,27+,28+/m0/s1 |
| InChIKey | FHHPCAFRQRYBKE-OQJNTFEFSA-N |
| XLogP | 4.17 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|