C39H52N2O8SSi2 — CID 56926142
[(4S)-4-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-4-trimethylsilyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 56926142) has the molecular formula C39H52N2O8SSi2 and a molecular weight of 765.09 g/mol. Its IUPAC name is [(4S)-4-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-4-trimethylsilyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(4S)-4-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-4-trimethylsilyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 56926142 |
| Molecular Formula | C39H52N2O8SSi2 |
| Molecular Weight | 765.09 g/mol |
| Exact Mass | 764.30 |
| IUPAC Name | [(4S)-4-[(2R,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-4-trimethylsilyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@H](O[Si](C)(C)C)[C@H]2O[C@@H](n3cc(C)c(=O)[nH]c3=O)C[C@@H]2O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C39H52N2O8SSi2/c1-28-21-23-30(24-22-28)50(44,45)46-25-15-20-33(48-51(6,7)8)36-34(26-35(47-36)41-27-29(2)37(42)40-38(41)43)49-52(39(3,4)5,31-16-11-9-12-17-31)32-18-13-10-14-19-32/h9-14,16-19,21-24,27,33-36H,15,20,25-26H2,1-8H3,(H,40,42,43)/t33-,34-,35+,36+/m0/s1 |
| InChIKey | QNTDBFCBVCGWPP-CLLHQPRTSA-N |
| XLogP | 5.79 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.09 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|