C16H27FN2O5Si — CID 162744545
1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 162744545) has the molecular formula C16H27FN2O5Si and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162744545 |
| Molecular Formula | C16H27FN2O5Si |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(1R)-1-hydroxyethyl]oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | C[C@@H](O)[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27FN2O5Si/c1-9(20)13-11(24-25(5,6)16(2,3)4)7-12(23-13)19-8-10(17)14(21)18-15(19)22/h8-9,11-13,20H,7H2,1-6H3,(H,18,21,22)/t9-,11+,12-,13-/m1/s1 |
| InChIKey | ZEYDWAVGKFTMMM-GWNIPJSYSA-N |
| XLogP | 1.73 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|