C9H11ClFN2O7P — CID 18667133
[(2S,3S,5R)-2-(chloromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 18667133) has the molecular formula C9H11ClFN2O7P and a molecular weight of 344.62 g/mol. Its IUPAC name is [(2S,3S,5R)-2-(chloromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2S,3S,5R)-2-(chloromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18667133 |
| Molecular Formula | C9H11ClFN2O7P |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | [(2S,3S,5R)-2-(chloromethyl)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](OP(=O)(O)O)[C@@H](CCl)O2)cc1F |
| InChI | InChI=1S/C9H11ClFN2O7P/c10-2-6-5(20-21(16,17)18)1-7(19-6)13-3-4(11)8(14)12-9(13)15/h3,5-7H,1-2H2,(H,12,14,15)(H2,16,17,18)/t5-,6+,7+/m0/s1 |
| InChIKey | DCRNFILJSKHCEC-RRKCRQDMSA-N |
| XLogP | -0.32 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|