C14H19FN2O9 — CID 72697979
1-[(2R,4S,5R)-4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione (PubChem CID 72697979) has the molecular formula C14H19FN2O9 and a molecular weight of 378.31 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 72697979 |
| Molecular Formula | C14H19FN2O9 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5-(hydroxymethyl)oxolan-2-yl]-5-fluoropyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n([C@H]2C[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)[C@@H](CO)O2)cc1F |
| InChI | InChI=1S/C14H19FN2O9/c15-5-2-17(14(23)16-12(5)22)9-1-6(7(3-18)24-9)25-13-11(21)10(20)8(4-19)26-13/h2,6-11,13,18-21H,1,3-4H2,(H,16,22,23)/t6-,7+,8+,9+,10+,11+,13+/m0/s1 |
| InChIKey | XANIMQWBISZBOQ-CWCVAHJQSA-N |
| XLogP | -3.22 |
| TPSA | 163.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |