C12H16FN2O8P — CID 170688842
[1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]cyclobutyl] dihydrogen phosphate (PubChem CID 170688842) has the molecular formula C12H16FN2O8P and a molecular weight of 366.24 g/mol. Its IUPAC name is [1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]cyclobutyl] dihydrogen phosphate.
| Compound Name | [1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]cyclobutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 170688842 |
| Molecular Formula | C12H16FN2O8P |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | [1-[(2S,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]cyclobutyl] dihydrogen phosphate |
| SMILES | O=c1[nH]c(=O)n([C@H]2CC(O)[C@@H](C3(OP(=O)(O)O)CCC3)O2)cc1F |
| InChI | InChI=1S/C12H16FN2O8P/c13-6-5-15(11(18)14-10(6)17)8-4-7(16)9(22-8)12(2-1-3-12)23-24(19,20)21/h5,7-9,16H,1-4H2,(H,14,17,18)(H2,19,20,21)/t7?,8-,9+/m1/s1 |
| InChIKey | FWBWSGBMHHRATA-ASODMVGOSA-N |
| XLogP | -0.64 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|